For research use only. Not for therapeutic Use.
N-Acetylprocainamide (NAPA) (Cat No.: I003161) is the primary active metabolite of procainamide, an antiarrhythmic drug used to treat cardiac arrhythmias. Formed in the liver via acetylation, NAPA retains antiarrhythmic properties, primarily acting as a Class III agent by prolonging the cardiac action potential. Monitoring NAPA levels is crucial during procainamide therapy, as elevated concentrations can contribute to proarrhythmic effects and toxicity. NAPA is significant in clinical pharmacokinetics and therapeutic drug monitoring, helping optimize dosage and safety in patients receiving procainamide treatment for arrhythmias.
| CAS Number | 32795-44-1 |
| Molecular Formula | C15H23N3O2 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Solubility | 10 mM in DMSO |
| Storage | 3 years -20C powder |
| IUPAC Name | 4-acetamido-N-[2-(diethylamino)ethyl]benzamide |
| InChI | 1S/C15H23N3O2/c1-4-18(5-2)11-10-16-15(20)13-6-8-14(9-7-13)17-12(3)19/h6-9H,4-5,10-11H2,1-3H3,(H,16,20)(H,17,19) |
| InChIKey | KEECCEWTUVWFCV-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(=O)C1=CC=C(C=C1)NC(=O)C |
| Reference | <p style=/line-height:25px/> |
