For research use only. Not for therapeutic Use.
N-Acetylputrescine(Cat No.:I041452)is a derivative of putrescine, a diamine formed through the decarboxylation of ornithine. In N-acetylputrescine, the amine group of putrescine is acetylated, forming an N-acetyl derivative. This compound plays a role in cellular processes such as polyamine metabolism and is involved in the regulation of cell growth and differentiation. N-Acetylputrescine is found in various biological systems, including plants and microorganisms. It has potential applications in research on cellular signaling, growth regulation, and metabolic pathways. Additionally, it can be used in synthetic chemistry and as an intermediate in the production of other compounds.
CAS Number | 5699-41-2 |
Synonyms | N-(4-aminobutyl)acetamide |
Molecular Formula | C6H14N2O |
Purity | ≥95% |
IUPAC Name | N-(4-aminobutyl)acetamide |
InChI | InChI=1S/C6H14N2O/c1-6(9)8-5-3-2-4-7/h2-5,7H2,1H3,(H,8,9) |
InChIKey | KLZGKIDSEJWEDW-UHFFFAOYSA-N |
SMILES | CC(=O)NCCCCN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |