For research use only. Not for therapeutic Use.
N-Allylnorlysergic Acid N,N-Diethylamide is a high-purity compound essential for advanced pharmaceutical and biochemical research. This lysergic acid derivative is crucial for studies involving receptor binding, psychopharmacology, and neurotransmitter activity. Known for its stability and precise chemical properties, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in various scientific applications.
| Catalog Number | R021897 |
| CAS Number | 65527-61-9 |
| Molecular Formula | C22H27N3O |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | (6aR,9R)-N,N-diethyl-7-prop-2-enyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| InChI | InChI=1S/C22H27N3O/c1-4-10-25-14-16(22(26)24(5-2)6-3)11-18-17-8-7-9-19-21(17)15(13-23-19)12-20(18)25/h4,7-9,11,13,16,20,23H,1,5-6,10,12,14H2,2-3H3/t16-,20-/m1/s1 |
| InChIKey | JCQLEPDZFXGHHQ-OXQOHEQNSA-N |
| SMILES | CCN(CC)C(=O)C1CN(C2CC3=CNC4=CC=CC(=C34)C2=C1)CC=C |
