For research use only. Not for therapeutic Use.
N-alpha-acetyl-L-arginine(Cat No.:M068480), also known as acetylated arginine, is a modified form of the amino acid arginine. The “N-alpha-acetyl” designation indicates that the acetyl group is attached to the nitrogen atom at the beginning of the arginine molecule. This modification can alter the chemical properties of arginine, potentially affecting its functions in biological processes. Arginine itself plays crucial roles in protein synthesis, wound healing, immune function, and hormone secretion.
Catalog Number | M068480 |
CAS Number | 155-84-0 |
Molecular Formula | C8H16N4O3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | (2S)-2-acetamido-5-(diaminomethylideneamino)pentanoic acid |
InChI | InChI=1S/C8H16N4O3/c1-5(13)12-6(7(14)15)3-2-4-11-8(9)10/h6H,2-4H2,1H3,(H,12,13)(H,14,15)(H4,9,10,11)/t6-/m0/s1 |
InChIKey | SNEIUMQYRCDYCH-LURJTMIESA-N |
SMILES | CC(=O)NC(CCCN=C(N)N)C(=O)O |