For research use only. Not for therapeutic Use.
N-benzhydrylbenzamide(Cat No.:M132544) is a chemical compound used in organic synthesis and pharmaceutical research. It consists of a benzhydryl group attached to an amide functional group on a benzene ring. This compound is known for its use as a building block in the synthesis of various pharmaceuticals and bioactive molecules. The benzhydryl group, which contains two phenyl rings connected by a central carbon, can impart steric hindrance and enhance the stability of the amide bond. This compound is often used in the development of new drugs due to its ability to modify the pharmacokinetic and pharmacodynamic properties of molecules.
CAS Number | 1485-72-9 |
Synonyms | N-BENZHYDRYL-BENZAMIDE |
Molecular Formula | C20H17NO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-benzhydrylbenzamide |
InChI | InChI=1S/C20H17NO/c22-20(18-14-8-3-9-15-18)21-19(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-15,19H,(H,21,22) |
InChIKey | NAMNSMRPXCPPFE-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)NC(=O)C3=CC=CC=C3 |