For research use only. Not for therapeutic Use.
N-Benzoyl-2′-deoxyadenosine(Cat No.:R072792)is a modified nucleoside analog of deoxyadenosine, characterized by the addition of a benzoyl group at the nitrogen position. This structural modification enhances its biochemical properties and potential therapeutic applications. It serves as a valuable tool in research, particularly in studies involving nucleic acid metabolism and antiviral drug development. N-Benzoyl-2′-deoxyadenosine can interfere with nucleic acid synthesis, making it a candidate for exploring mechanisms of action in viral infections and cancer. Its unique chemical properties offer insights into the design of novel nucleoside analogs for therapeutic purposes.
CAS Number | 4546-72-9 |
Molecular Formula | C17H17N5O4 |
Purity | ≥95% |
IUPAC Name | N-[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
InChI | InChI=1S/C17H17N5O4/c23-7-12-11(24)6-13(26-12)22-9-20-14-15(18-8-19-16(14)22)21-17(25)10-4-2-1-3-5-10/h1-5,8-9,11-13,23-24H,6-7H2,(H,18,19,21,25)/t11-,12+,13+/m0/s1 |
InChIKey | PIXHJAPVPCVZSV-YNEHKIRRSA-N |
SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)NC(=O)C4=CC=CC=C4)CO)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |