For research use only. Not for therapeutic Use.
N-benzyl-3,4-dichloroaniline (Cat.No:L003466) is a crucial chemical compound utilized in the synthesis of specialized materials and pharmaceuticals. Its structure, featuring a dichloroaniline core and a benzyl group, imparts distinctive reactivity and properties. This compound serves as a key intermediate in the production of various pharmaceutical agents, underscoring its significance in medicinal chemistry and the broader chemical industry.
Catalog Number | L003466 |
CAS Number | 51597-75-2 |
Molecular Formula | C13H11Cl2N |
Purity | ≥95% |
IUPAC Name | N-benzyl-3,4-dichloroaniline |
InChI | InChI=1S/C13H11Cl2N/c14-12-7-6-11(8-13(12)15)16-9-10-4-2-1-3-5-10/h1-8,16H,9H2 |
InChIKey | PYRNSWQKFKLMLR-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)CNC2=CC(=C(C=C2)Cl)Cl |