For research use only. Not for therapeutic Use.
N-Benzyldiethylamine-d4 is a deuterated form of N-benzyldiethylamine, featuring four deuterium atoms. This compound is used primarily in chemical and pharmaceutical research for its enhanced stability and precision in analytical techniques such as NMR and mass spectrometry. N-Benzyldiethylamine is a secondary amine used in various organic synthesis processes and as a reagent in chemical reactions. The deuterium labeling allows for detailed tracking of reaction mechanisms, metabolic pathways, and interactions in biological systems. It is valuable for studying the behavior of amines in different chemical environments and optimizing synthetic procedures.
CAS Number | 772-54-3 |
Synonyms | Benzyldiethylamine-d4; Diethylbenzylamine; N,N-Diethylbenzylamine-d4; N-(Phenylmethyl)diethylamine-d4; N-Benzyl-N,N-diethylamine-d4; N,N-Diethylbenzylamine-d4;?N,N-Diethylbenzenemethanamine-d4 |
Molecular Formula | C11H17N |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | N-benzyl-N-ethylethanamine |
InChI | InChI=1S/C11H17N/c1-3-12(4-2)10-11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3 |
InChIKey | ZWRDBWDXRLPESY-UHFFFAOYSA-N |
SMILES | CCN(CC)CC1=CC=CC=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |