For research use only. Not for therapeutic Use.
N-Benzyllinolenamide（Cat No.:R065882）is an amide derivative of linolenic acid, characterized by a benzyl group attached to the nitrogen atom. Known for its bioactive properties, it is studied for potential applications in anti-inflammatory and antioxidant therapies. The compound’s structure allows it to interact with lipid metabolism pathways, and it shows promise in modulating cellular responses to oxidative stress. Additionally, N-Benzyllinolenamide’s affinity for specific receptors suggests its potential role in skin health and neuroprotection research, contributing to ongoing studies in lipid-based therapeutic agents.
| Catalog Number | R065882 |
| CAS Number | 883715-18-2 |
| Molecular Formula | C25H37NO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (9Z,12Z,15Z)-N-benzyloctadeca-9,12,15-trienamide |
| InChI | InChI=1S/C25H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-25(27)26-23-24-20-17-16-18-21-24/h3-4,6-7,9-10,16-18,20-21H,2,5,8,11-15,19,22-23H2,1H3,(H,26,27)/b4-3-,7-6-,10-9- |
| InChIKey | VCMMYRWIEZCYDK-PDBXOOCHSA-N |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)NCC1=CC=CC=C1 |
