Home
>
Inhibitors/Agonists>Reference Standards>Chemical Reagents>Bioactive Chemicals>Organic Building Blocks>Synthetic Reagents>Heterocycles> N-Benzylquinazolin-4-amine
For research use only. Not for therapeutic Use.
N-Benzylquinazolin-4-amine is an organic compound consisting of a quinazoline core structure, a bicyclic aromatic system, with an amine group (-NH₂) attached at the 4th position and a benzyl group (-CH₂C₆H₅) attached to the nitrogen atom. This compound and its derivatives are often studied for their potential biological activities, including anticancer, antifungal, and antimicrobial properties. Quinazoline derivatives, in particular, have been of interest in pharmaceutical research due to their ability to interact with various biological targets, such as enzymes or receptors, making them candidates for drug development and medicinal chemistry studies.
Catalog Number | M189943 |
CAS Number | 100818-54-0 |
Molecular Formula | C15H13N3 |
Purity | ≥95% |
IUPAC Name | N-benzylquinazolin-4-amine |
InChI | InChI=1S/C15H13N3/c1-2-6-12(7-3-1)10-16-15-13-8-4-5-9-14(13)17-11-18-15/h1-9,11H,10H2,(H,16,17,18) |
InChIKey | FVWANTDQRFSCAL-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)CNC2=NC=NC3=CC=CC=C32 |