For research use only. Not for therapeutic Use.
N-Benzylquinine chloride(Cat No.:I041112)is a chemical compound derived from quinine, a natural alkaloid with well-known antimalarial properties. In this derivative, a benzyl group is attached to the nitrogen atom of the quinine structure, modifying its chemical properties and potentially enhancing its pharmacological activity. N-Benzylquinine chloride has been studied for its potential in various therapeutic areas, including its antimicrobial, anti-inflammatory, and antimalarial effects. It may offer advantages in drug formulation, improving solubility, stability, or bioavailability. Research continues to explore its applications and efficacy in treating malaria and other diseases.
CAS Number | 67174-25-8 |
Synonyms | (R)-[(2S)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;chloride |
Molecular Formula | C27H31ClN2O2 |
Purity | ≥95% |
IUPAC Name | (R)-[(2S,4S,5R)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;chloride |
InChI | InChI=1S/C27H31N2O2.ClH/c1-3-20-18-29(17-19-7-5-4-6-8-19)14-12-21(20)15-26(29)27(30)23-11-13-28-25-10-9-22(31-2)16-24(23)25;/h3-11,13,16,20-21,26-27,30H,1,12,14-15,17-18H2,2H3;1H/q+1;/p-1/t20-,21-,26-,27+,29?;/m0./s1 |
InChIKey | JYDIJFKNXHPWBJ-UNGVVQABSA-M |
SMILES | COC1=CC2=C(C=CN=C2C=C1)[C@H]([C@@H]3C[C@@H]4CC[N+]3(C[C@@H]4C=C)CC5=CC=CC=C5)O.[Cl-] |