Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> N-Boc-3-[4-(piperidin-4-yloxy)phenyl]propanoic acid
For research use only. Not for therapeutic Use.
N-Boc-3-[4-(piperidin-4-yloxy)phenyl]propanoic acid(Cat No.:L010271), is a chemical compound used in organic synthesis and pharmaceutical research. It is a propanoic acid derivative with a tert-butoxycarbonyl (Boc) protecting group on the nitrogen atom and a piperidin-4-yloxy group attached to the phenyl ring. This compound is a crucial intermediate in the synthesis of various organic molecules and pharmaceutical agents, making it valuable in drug development and medicinal chemistry research.
CAS Number | 1080421-71-1 |
Molecular Formula | C19H27NO5 |
Purity | ≥95% |
IUPAC Name | 3-[4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxyphenyl]propanoic acid |
InChI | InChI=1S/C19H27NO5/c1-19(2,3)25-18(23)20-12-10-16(11-13-20)24-15-7-4-14(5-8-15)6-9-17(21)22/h4-5,7-8,16H,6,9-13H2,1-3H3,(H,21,22) |
InChIKey | UEJYYEFFCTVVEP-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1CCC(CC1)OC2=CC=C(C=C2)CCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |