For research use only. Not for therapeutic Use.
n-Butoxyacetic acid-d9(Cat No.:I041490)is a deuterated derivative of n-butoxyacetic acid, where nine hydrogen atoms are replaced with deuterium isotopes. This modification makes it useful in analytical chemistry, particularly in studies involving isotopic labeling. It is commonly used in the detection and quantification of substances in complex mixtures, as deuterated compounds are easily distinguished from their non-deuterated counterparts in nuclear magnetic resonance (NMR) spectroscopy. n-Butoxyacetic acid-d9 is also used in pharmacokinetic studies and environmental testing, helping track metabolic pathways or trace chemical sources in various scientific applications.
CAS Number | 669720-55-2 |
Synonyms | 2-(1,1,2,2,3,3,4,4,4-nonadeuteriobutoxy)acetic acid |
Molecular Formula | C6H3D9O3 |
Purity | ≥95% |
IUPAC Name | 2-(1,1,2,2,3,3,4,4,4-nonadeuteriobutoxy)acetic acid |
InChI | InChI=1S/C6H12O3/c1-2-3-4-9-5-6(7)8/h2-5H2,1H3,(H,7,8)/i1D3,2D2,3D2,4D2 |
InChIKey | AJQOASGWDCBKCJ-YNSOAAEFSA-N |
SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])OCC(=O)O |