For research use only. Not for therapeutic Use.
N-Caproyl-L-Homoserine Lactone (C6-HSL)(Cat No.:M009356)is a small signaling molecule belonging to the N-acyl homoserine lactone family, commonly used in quorum sensing studies in Gram-negative bacteria. This compound enables bacterial cells to communicate by diffusing across cell membranes and binding to specific receptors, thereby regulating gene expression in response to population density. C6-HSL plays a critical role in coordinating behaviors like biofilm formation, virulence, and motility in microbial communities. Its stability and efficacy in mimicking natural quorum-sensing processes make it essential for research into bacterial communication and potential antimicrobial strategies.
CAS Number | 106983-28-2 |
Molecular Formula | C10H17NO3 |
Purity | ≥95% |
Target | Bacterial |
Storage | -80°C |
IUPAC Name | N-(2-oxooxolan-3-yl)hexanamide |
InChI | InChI=1S/C10H17NO3/c1-2-3-4-5-9(12)11-8-6-7-14-10(8)13/h8H,2-7H2,1H3,(H,11,12) |
InChIKey | ZJFKKPDLNLCPNP-UHFFFAOYSA-N |
SMILES | CCCCCC(=O)NC1CCOC1=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |