For research use only. Not for therapeutic Use.
N-cyano-N’, N’-dimethylguanidine(Cat No.:M123925), is a chemical compound used in various chemical and industrial applications. Its chemical structure consists of a guanidine group with two methyl groups and a cyano group attached to the nitrogen atoms. N-cyano-N’, N’-dimethylguanidine is commonly used as a base in chemical reactions to promote condensation, alkylation, and other transformations. Its ability to participate in various reactions makes it valuable in the production of pharmaceuticals, agrochemicals, and specialty chemicals.
Catalog Number | M123925 |
CAS Number | 1609-06-9 |
Molecular Formula | C4H8N4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-cyano-1,1-dimethylguanidine |
InChI | InChI=1S/C4H8N4/c1-8(2)4(6)7-3-5/h1-2H3,(H2,6,7) |
InChIKey | TUYAIZHPVZJKIN-UHFFFAOYSA-N |
SMILES | CN(C)C(=NC#N)N |