Home
>
Metabolic Enzyme/Protease>FAAH> N-Cyclohexyl-N-methyl-4-(1-oxido-3-pyridinyl)-1H-imidazole-1-carboxamide
For research use only. Not for therapeutic Use.
N-Cyclohexyl-N-methyl-4-(1-oxido-3-pyridinyl)-1H-imidazole-1-carboxamide(Cat No.:R033071)is a synthetic compound designed for research in biochemical and pharmacological studies. Its structure features a cyclohexyl-methyl substitution, a pyridinyl oxido group, and an imidazole carboxamide core, contributing to potential receptor binding affinity and biological activity. This compound is explored for its possible modulatory effects on signaling pathways and receptor interactions, making it relevant in neuropharmacology and enzyme inhibition studies. With its intricate structure, it serves as a tool for understanding molecular mechanisms in drug development and therapeutic research across various biomedical fields.
CAS Number | 1233855-46-3 |
Synonyms | 3-(1-(Cyclohexyl(methyl)carbamoyl)-1H-imidazol-4-yl)pyridine 1-Oxide |
Molecular Formula | C₁₆H₂₀N₄O₂ |
Purity | ≥95% |
Target | Neuronal Signaling |
Storage | -20°C |
IUPAC Name | N-cyclohexyl-N-methyl-4-(1-oxidopyridin-1-ium-3-yl)imidazole-1-carboxamide |
InChI | InChI=1S/C16H20N4O2/c1-18(14-7-3-2-4-8-14)16(21)19-11-15(17-12-19)13-6-5-9-20(22)10-13/h5-6,9-12,14H,2-4,7-8H2,1H3 |
InChIKey | DOWVMJFBDGWVML-UHFFFAOYSA-N |
SMILES | CN(C1CCCCC1)C(=O)N2C=C(N=C2)C3=C[N+](=CC=C3)[O-] |