For research use only. Not for therapeutic Use.
N-cyclopropylcyclohexanamine hydrochloride(Cat No.:L006860), is a chemical compound commonly used in organic synthesis and medicinal chemistry. Its molecular structure comprises a cyclopropyl group attached to a cyclohexylamine moiety, and it exists in the hydrochloride salt form, enhancing its stability and solubility. This compound serves as a valuable intermediate in the preparation of various organic derivatives and pharmaceuticals. Chemists utilize it to introduce specific functionalities in organic molecules, allowing for the creation of diverse compounds for research and drug development.
CAS Number | 874-64-6 |
Molecular Formula | C9H18ClN |
Purity | ≥95% |
IUPAC Name | N-cyclopropylcyclohexanamine;hydrochloride |
InChI | InChI=1S/C9H17N.ClH/c1-2-4-8(5-3-1)10-9-6-7-9;/h8-10H,1-7H2;1H |
InChIKey | BHEJSAFRFRRXIR-UHFFFAOYSA-N |
SMILES | C1CCC(CC1)NC2CC2.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |