For research use only. Not for therapeutic Use.
N-Desethyl Amodiaquine-d5 is a deuterated metabolite of Amodiaquine, used extensively in antimalarial research. This isotopically labeled compound, featuring five deuterium atoms, is essential for studying the pharmacokinetics, metabolism, and efficacy of Amodiaquine. Its stable isotope labeling ensures precise and reliable analytical results. N-Desethyl Amodiaquine-d5 is highly valued for its purity and stability, making it a crucial tool for drug development and the advancement of effective malaria treatments, contributing significantly to global health research.
Catalog Number | R006911 |
CAS Number | 1173023-19-2 |
Synonyms | 4-[(7-Chloro-4-quinolinyl)amino]-2-[(ethyl-d5-amino)methyl]phenol; Monodesethylamodiaquine-d5; Desethylamodiaquine-d5; |
Molecular Formula | C18H18ClN3O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-[(7-chloroquinolin-4-yl)amino]-2-[(1,1,2,2,2-pentadeuterioethylamino)methyl]phenol |
InChI | InChI=1S/C18H18ClN3O/c1-2-20-11-12-9-14(4-6-18(12)23)22-16-7-8-21-17-10-13(19)3-5-15(16)17/h3-10,20,23H,2,11H2,1H3,(H,21,22)/i1D3,2D2 |
InChIKey | VRXFDHAGFYWGHT-ZBJDZAJPSA-N |
SMILES | CCNCC1=C(C=CC(=C1)NC2=C3C=CC(=CC3=NC=C2)Cl)O |