For research use only. Not for therapeutic Use.
N-Desethyl Amodiaquine Dihydrochloride(Cat No.:R044849)is a key metabolite of amodiaquine, a widely used antimalarial drug. This compound is critical in pharmaceutical research, particularly in studies related to the pharmacokinetics and metabolism of antimalarial agents. N-Desethyl Amodiaquine Dihydrochloride plays a significant role in evaluating drug efficacy, safety, and potential drug interactions. Its stability and chemical properties make it a valuable reference standard for analytical testing, ensuring accurate determination of amodiaquine’s therapeutic levels and metabolism. This metabolite is crucial for advancing the development of more effective antimalarial therapies.
Catalog Number | R044849 |
CAS Number | 79049-30-2 |
Synonyms | 4-[(7-Chloro-4-quinolinyl)amino]-2-[(ethylamino)methyl]phenol Dihydrochloride; 4-(7-Chloro-4-quinolylamino)-α-ethylamino-o-cresol Dihydrochloride |
Molecular Formula | C18H20Cl3N3O |
Purity | ≥95% |
Target | Parasite |
Storage | Desiccate at RT |
IUPAC Name | 4-[(7-chloroquinolin-4-yl)amino]-2-(ethylaminomethyl)phenol;dihydrochloride ide |
InChI | InChI=1S/C18H18ClN3O.2ClH/c1-2-20-11-12-9-14(4-6-18(12)23)22-16-7-8-21-17-10-13(19)3-5-15(16)17;;/h3-10,20,23H,2,11H2,1H3,(H,21,22);2*1H |
InChIKey | BCYBRFGUODDEGH-UHFFFAOYSA-N |
SMILES | CCNCC1=C(C=CC(=C1)NC2=C3C=CC(=CC3=NC=C2)Cl)O.Cl.Cl |