For research use only. Not for therapeutic Use.
N-Desisopropyl Metoprolol-d5 is a deuterated form of N-desisopropyl metoprolol, a metabolite of metoprolol, a beta-blocker used to manage hypertension and other cardiovascular conditions. The five deuterium atoms replace hydrogen atoms in the molecule, providing a stable isotopic label that enhances precision in pharmacokinetic and metabolic studies. This labeled compound is useful for accurately tracking the drug’s absorption, distribution, metabolism, and excretion in biological systems. Its applications include studying drug interactions, optimizing dosing regimens, and improving therapeutic strategies for treating cardiovascular diseases.
| Catalog Number | R054964 |
| CAS Number | 1794979-77-3 |
| Synonyms | 1-Amino-3-[4-(2-methoxyethyl)phenoxy]-2-propanol-d5; H 98/52-d5; |
| Molecular Formula | C12H19NO3 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | 1-amino-1,1,2,3,3-pentadeuterio-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol |
| InChI | InChI=1S/C12H19NO3/c1-15-7-6-10-2-4-12(5-3-10)16-9-11(14)8-13/h2-5,11,14H,6-9,13H2,1H3/i8D2,9D2,11D |
| InChIKey | XJWXVDJGNOHFLR-QJHRKUAUSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])OC1=CC=C(C=C1)CCOC)O)N |
