For research use only. Not for therapeutic Use.
N-Despropyl Propafenone Hydrochloride(CAT: R044655) is a key metabolite of propafenone, a class 1C antiarrhythmic agent. It is formed by the metabolic process in the liver, where the parent compound, propafenone, undergoes N-dealkylation. This metabolite retains some pharmacological activity similar to the parent drug, which is primarily used to treat irregular heartbeats, such as atrial fibrillation and ventricular arrhythmias. N-Despropyl Propafenone Hydrochloride is often studied to understand the pharmacokinetics and metabolism of propafenone and its impact on the therapeutic efficacy and safety profile of the drug in patients. It plays a significant role in drug metabolism research and clinical pharmacology.
CAS Number | 1188263-52-6 |
Synonyms | 1-[2-(3-Amino-2-hydroxypropoxy)phenyl]-3-phenyl-1-propanone Hydrochloride |
Molecular Formula | C18H22ClNO3 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 1-[2-(3-amino-2-hydroxypropoxy)phenyl]-3-phenylpropan-1-one;hydrochloride |
InChI | InChI=1S/C18H21NO3.ClH/c19-12-15(20)13-22-18-9-5-4-8-16(18)17(21)11-10-14-6-2-1-3-7-14;/h1-9,15,20H,10-13,19H2;1H |
InChIKey | PJHPAIZGMQFXFZ-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)CCC(=O)C2=CC=CC=C2OCC(CN)O.Cl |