For research use only. Not for therapeutic Use.
N-Dodecane-d26(Cat No.:M087347)is a deuterated form of n-dodecane, featuring twenty-six deuterium atoms. This high-purity compound is essential in advanced pharmaceutical, chemical, and environmental research, particularly in studying hydrocarbon metabolism and chemical reaction mechanisms. Its stable isotope labeling ensures precise and accurate mass spectrometric analysis, aiding investigations into metabolic pathways, environmental impact assessments, and the development of new materials. With consistent and reliable performance, N-Dodecane-d26 is ideal for rigorous experimental setups, offering a robust and cost-effective solution for high-precision scientific research and the development of novel chemical applications.
CAS Number | 16416-30-1 |
Molecular Formula | C12D26 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-hexacosadeuteriododecane |
InChI | InChI=1S/C12H26/c1-3-5-7-9-11-12-10-8-6-4-2/h3-12H2,1-2H3/i1D3,2D3,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2 |
InChIKey | SNRUBQQJIBEYMU-DWXHPOBZSA-N |
SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |