Home
>
Isotope Labeled Compounds>Isotope Labeled Synthetic Intermediates> N-Ethyl-3-buteno-o-toluidide-d7
For research use only. Not for therapeutic Use.
N-Ethyl-3-buteno-o-toluidide-d7 is a deuterated form of N-ethyl-3-buteno-o-toluidide, where seven deuterium atoms are incorporated into the molecule. This compound is used in chemical research and synthesis applications. The deuterium labeling enhances the precision of tracking the compound’s behavior, reaction mechanisms, and metabolic pathways. It is particularly useful for studying chemical transformations, reaction kinetics, and interactions with other substances. The detailed insights provided by the deuterium labeling are crucial for optimizing synthesis processes and understanding the compound’s role in various chemical and biological systems.
CAS Number | NA |
Synonyms | N-Ethyl-N-(2-methylphenyl)-3-butenamide-d7 |
Molecular Formula | C₁₃H₁₀D₇NO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-ethyl-N-[2,3,4,5-tetradeuterio-6-(trideuteriomethyl)phenyl]but-3-enamide |
InChI | InChI=1S/C13H17NO/c1-4-8-13(15)14(5-2)12-10-7-6-9-11(12)3/h4,6-7,9-10H,1,5,8H2,2-3H3/i3D3,6D,7D,9D,10D |
InChIKey | NXXVQNLYGNUDLL-MXFCRNHQSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1[2H])C([2H])([2H])[2H])N(CC)C(=O)CC=C)[2H])[2H] |