Home
>
Chemical Reagents> n-Ethyl-n-(2-hydroxy-3-sulfopropyl)-3,5-dimethylaniline sodium salt monohydrate
For research use only. Not for therapeutic Use.
n-Ethyl-n-(2-hydroxy-3-sulfopropyl)-3,5-dimethylaniline sodium salt monohydrate(Cat No.:L006878), is a chemical compound used in analytical and biochemical research. Its molecular structure consists of an aniline derivative with an ethyl group, a sulfopropyl group, and two methyl groups, all connected to a sodium cation. This compound is employed in various analytical methods, including spectrophotometry and chromatography, as a reagent to detect and quantify trace amounts of certain substances. Its water-soluble nature and specific chemical properties make it useful in these applications.
Catalog Number | L006878 |
CAS Number | 82692-97-5 |
Molecular Formula | C13H20NNaO4S |
Purity | ≥95% |
IUPAC Name | sodium;3-(N-ethyl-3,5-dimethylanilino)-2-hydroxypropane-1-sulfonate |
InChI | InChI=1S/C13H21NO4S.Na/c1-4-14(8-13(15)9-19(16,17)18)12-6-10(2)5-11(3)7-12;/h5-7,13,15H,4,8-9H2,1-3H3,(H,16,17,18);/q;+1/p-1 |
InChIKey | HLXGRHNZZSMNRX-UHFFFAOYSA-M |
SMILES | CCN(CC(CS(=O)(=O)[O-])O)C1=CC(=CC(=C1)C)C.[Na+] |