For research use only. Not for therapeutic Use.
N-Ethyladenine(CAT: L000088) is a significant compound with applications in organic chemistry and pharmaceutical research. This chemical is a derivative of adenine, featuring an ethyl group. It plays an essential role in the synthesis of various organic molecules, particularly in the development of pharmaceutical agents and nucleoside analogs. This compound’s structural modifications make it valuable in drug discovery and medicinal chemistry.
CAS Number | 16370-43-7 |
Molecular Formula | C7H9N5 |
Purity | ≥95% |
IUPAC Name | N-ethyl-7H-purin-6-amine |
InChI | InChI=1S/C7H9N5/c1-2-8-6-5-7(10-3-9-5)12-4-11-6/h3-4H,2H2,1H3,(H2,8,9,10,11,12) |
InChIKey | GSVFENCKYURWTI-UHFFFAOYSA-N |