For research use only. Not for therapeutic Use.
N-Ethylurea is a high-purity compound essential for advanced pharmaceutical and chemical research. This urea derivative is crucial for studies involving organic synthesis, medicinal chemistry, and as an intermediate in chemical manufacturing. Known for its stability and reactivity, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in various scientific applications.
Catalog Number | R019501 |
CAS Number | 625-52-5 |
Synonyms | 1-Ethylurea; Ethylurea; NSC 53556 |
Molecular Formula | C3H8N2O |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | ethylurea |
InChI | InChI=1S/C3H8N2O/c1-2-5-3(4)6/h2H2,1H3,(H3,4,5,6) |
InChIKey | RYECOJGRJDOGPP-UHFFFAOYSA-N |
SMILES | CCNC(=O)N |