For research use only. Not for therapeutic Use.
N-Formyl Amlodipine (Cat No.:C000669) is a derivative of amlodipine, a widely prescribed calcium channel blocker used to treat hypertension and angina. The addition of a formyl group modifies its chemical structure. Amlodipine works by relaxing blood vessels, reducing blood pressure, and improving blood flow. Research on N-Formyl Amlodipine may explore its pharmacological activities, interactions with calcium channels, and potential effects on cardiovascular health.
| Catalog Number | C000669 |
| CAS Number | 93848-81-8 |
| Synonyms | 4-(2-Chlorophenyl)-2-[[2-(formylamino)ethoxy]methyl]-1,4-dihydro-6-methyl-,3,5-pyridinedicarboxylic Acid 3-ethyl 5-methyl Ester |
| Molecular Formula | C₂₁H₂₅ClN₂O₆ |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), DMSO (Slightly) |
| Appearance | White to Off-White Solid |
| Storage | -20°C, Inert atmosphere |
| IUPAC Name | 3-O-ethyl 5-O-methyl 4-(2-chlorophenyl)-2-(2-formamidoethoxymethyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChI | InChI=1S/C21H25ClN2O6/c1-4-30-21(27)19-16(11-29-10-9-23-12-25)24-13(2)17(20(26)28-3)18(19)14-7-5-6-8-15(14)22/h5-8,12,18,24H,4,9-11H2,1-3H3,(H,23,25) |
| InChIKey | XEJRHYXNQHVXRJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=CC=CC=C2Cl)C(=O)OC)C)COCCNC=O |
| Reference | Alker, D., et al.: Pat. Appl.В (1984),В EPВ 119050В A2В 19840919 |
