For research use only. Not for therapeutic Use.
N-formyl-L-glutamic acid(Cat No.:M119418) is a derivative of the amino acid L-glutamic acid, where a formyl group (H-C=O) is attached to the amino group (-NH2) of glutamic acid. It has the chemical formula C6H9NO5 and is commonly referred to as N-formylglutamate. This compound plays a role in various biological processes, including protein synthesis, where it serves as the starting amino acid in the initiation of translation in prokaryotes. N-formyl-L-glutamic acid is also found in certain bacterial peptides and is involved in immune responses, inflammation, and cell signaling pathways.
CAS Number | 1681-96-5 |
Molecular Formula | C6H9NO5 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | (2S)-2-formamidopentanedioic acid |
InChI | InChI=1S/C6H9NO5/c8-3-7-4(6(11)12)1-2-5(9)10/h3-4H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t4-/m0/s1 |
InChIKey | ADZLWSMFHHHOBV-BYPYZUCNSA-N |
SMILES | C(CC(=O)O)C(C(=O)O)NC=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |