For research use only. Not for therapeutic Use.
N-Formylglycine Ethyl Ester（Cat No.:R058325）is a derivative of glycine, featuring a formyl group attached to the nitrogen atom and an ethyl ester at the carboxyl terminus. This compound appears as a colorless to light yellow liquid, with a boiling point of 267-269 °C at standard atmospheric pressure. It is soluble in common organic solvents, making it suitable for various organic synthesis applications. N-Formylglycine Ethyl Ester serves as an intermediate in the preparation of aminomethylene compounds and pyridine derivatives, which are explored as peptidomimetic inhibitors and antiviral agents. Additionally, it is utilized in the synthesis of ethyl isocyanoacetate, a valuable building block in organic chemistry.
| CAS Number | 3154-51-6 |
| Synonyms | ethyl 2-formamidoacetate |
| Molecular Formula | C5H9NO3 |
| Purity | ≥95% |
| IUPAC Name | ethyl 2-formamidoacetate |
| InChI | InChI=1S/C5H9NO3/c1-2-9-5(8)3-6-4-7/h4H,2-3H2,1H3,(H,6,7) |
| InChIKey | GMBCCEOJUWMBPF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNC=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
