For research use only. Not for therapeutic Use.
n-Heptane-d16 is a deuterated form of n-heptane, featuring sixteen deuterium atoms. This compound is used in chemical and environmental research to enhance the precision of analytical techniques such as NMR and mass spectrometry. n-Heptane is a linear alkane used as a solvent and in various chemical synthesis processes. The deuterium labeling allows for detailed studies of the compound’s reaction mechanisms, metabolic pathways, and interactions with other substances. It is valuable for tracing chemical transformations, optimizing synthetic processes, and understanding the behavior of hydrocarbons in different chemical and biological environments.
CAS Number | 33838-52-7 |
Synonyms | Dipropyl methane-d16, Eptani-d16, Gettysolve-C-d16 |
Molecular Formula | C7D16 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-hexadecadeuterioheptane |
InChI | InChI=1S/C7H16/c1-3-5-7-6-4-2/h3-7H2,1-2H3/i1D3,2D3,3D2,4D2,5D2,6D2,7D2 |
InChIKey | IMNFDUFMRHMDMM-NEBSKJCTSA-N |
SMILES | C(C(C(C([2H])([2H])[2H])([2H])[2H])([2H])[2H])(C(C(C([2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |