For research use only. Not for therapeutic Use.
N-Hexadecyl-6-nitro-4H-1,3,2-benzodioxaphosphorin-2-amine 2-sulfide(Cat No.:M115480) is a chemically synthesized organophosphorus compound characterized by a complex molecular structure. It features a phosphorus atom bonded to nitrogen and sulfur atoms, with a benzodioxaphosphorin ring system that includes a nitro group enhancing its reactivity. The long hexadecyl chain contributes to its hydrophobic nature, potentially influencing its interaction with biological membranes. This compound is of interest in material science and possibly in biochemistry for its unique properties, such as flame retardancy, and its potential as a reagent in specialized synthetic applications.
CAS Number | 130365-34-3 |
Synonyms | N-Hexadecyl-6-nitro-4H-1,3,2-benzodioxaphosphorin-2-amine 2-sulfide |
Molecular Formula | C23H39N2O4PS |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-hexadecyl-6-nitro-2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-amine |
InChI | InChI=1S/C23H39N2O4PS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18-24-30(31)28-20-21-19-22(25(26)27)16-17-23(21)29-30/h16-17,19H,2-15,18,20H2,1H3,(H,24,31) |
InChIKey | LBDUPNUHUSLPMT-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCCCCNP1(=S)OCC2=C(O1)C=CC(=C2)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |