For research use only. Not for therapeutic Use.
N-hydroxy-3,3′-iminodipropionitrile(Cat No.:M010039) is a chemical compound featuring an imine group linked to two propionitrile units, with a hydroxy group attached to the nitrogen of the imine. This structure makes it an interesting candidate for various chemical syntheses and applications. The nitrile groups provide reactive sites for further functionalization, which can be useful in the development of pharmaceuticals and polymers. The hydroxy group adds polarity and the potential for hydrogen bonding, enhancing solubility and reactivity. Its unique combination of functional groups makes it a versatile intermediate in organic synthesis, particularly in the creation of new materials or active pharmaceutical ingredients.
CAS Number | 108203-25-4 |
Synonyms | N-hydroxy-3,3′-iminodipropionitrile |
Molecular Formula | C6H9N3O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-[2-cyanoethyl(hydroxy)amino]propanenitrile |
InChI | InChI=1S/C6H9N3O/c7-3-1-5-9(10)6-2-4-8/h10H,1-2,5-6H2 |
InChIKey | ZTOQSCPKMKRDJF-UHFFFAOYSA-N |
SMILES | C(CN(CCC#N)O)C#N |