For research use only. Not for therapeutic Use.
N-Hydroxy Pomalidomide（Cat No.:C000229）, is a chemical compound and derivative of pomalidomide. Pomalidomide is a medication used in the treatment of certain types of cancer, particularly multiple myeloma. N-hydroxy pomalidomide is believed to be an intermediate in the synthesis of pomalidomide and may have pharmacological or biochemical significance. It could also be a compound of interest in pharmaceutical research and development, potentially contributing to the development of new drugs or therapies.
| Catalog Number | C000229 |
| CAS Number | 497147-11-2 |
| Synonyms | 2-(2,6-Dioxo-3-piperidinyl)-4-(hydroxyamino)-1H-isoindole-1,3(2H)-dione |
| Molecular Formula | C₁₃H₁₁N₃O₅ |
| Purity | ≥95% |
| Solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| Appearance | Pale Yellow to Light Yellow Solid |
| Storage | -20°C, Inert atmosphere |
| IUPAC Name | 3-(1,3-dihydroxy-4-nitrosoisoindol-2-yl)piperidine-2,6-dione |
| InChI | InChI=1S/C13H11N3O5/c17-9-5-4-8(11(18)14-9)16-12(19)6-2-1-3-7(15-21)10(6)13(16)20/h1-3,8,19-20H,4-5H2,(H,14,17,18) |
| InChIKey | RMKXSRCTDDVULP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=C3C=CC=C(C3=C2O)N=O)O |
| Reference | Shah, J., et al.: PCT Int. Appl., WO 2003014315 A2 20030220 (2003) |
