For research use only. Not for therapeutic Use.
N-Iodosaccharin (Cat.No:R034166) is a chemical compound known for its versatile reactivity in organic synthesis. It serves as a valuable reagent in various reactions, including halogenation and cyclization processes. This compound’s unique structure and reactivity make it a useful tool for creating diverse molecules in chemical research and development.
Catalog Number | R034166 |
CAS Number | 86340-94-5 |
Synonyms | 2-Iiodo–1,2-benzisothiazol-3(2H)-one 1,1-Dioxide |
Molecular Formula | C7H4INO3S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-iodo-1,1-dioxo-1,2-benzothiazol-3-one |
InChI | InChI=1S/C7H4INO3S/c8-9-7(10)5-3-1-2-4-6(5)13(9,11)12/h1-4H |
InChIKey | XQKQROJYWLWDMP-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=O)N(S2(=O)=O)I |