Home
>
Isotope Labeled Compounds>Isotope Labeled Synthetic Intermediates> N-ISO-PROPYL-D7-ACRYLAMIDE
For research use only. Not for therapeutic Use.
N-Isopropyl-d7-acrylamide is a deuterated analog of N-isopropylacrylamide, where seven hydrogen atoms in the isopropyl group have been replaced with deuterium. This isotopically labeled compound is used in polymer chemistry and material science research, particularly in the synthesis of temperature-responsive polymers, such as poly(N-isopropylacrylamide) (PNIPAM). The deuterium labeling allows for precise tracking and analysis in techniques like nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry, providing enhanced accuracy in studying polymer behavior, molecular dynamics, and phase transitions. N-Isopropyl-d7-acrylamide is essential for researchers developing smart materials and investigating the properties of responsive polymers in applications like drug delivery, tissue engineering, and environmental sensing.
Catalog Number | M124715 |
CAS Number | 1219803-32-3 |
Synonyms | N-ISO-PROPYL-D7-ACRYLAMIDE |
Molecular Formula | C6H4D7NO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)prop-2-enamide |
InChI | InChI=1S/C6H11NO/c1-4-6(8)7-5(2)3/h4-5H,1H2,2-3H3,(H,7,8)/i2D3,3D3,5D |
InChIKey | QNILTEGFHQSKFF-LUUPTHFTSA-N |
SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NC(=O)C=C |