For research use only. Not for therapeutic Use.
N-isobutylpyrimidin-2-amine(CAT: L000472) is a compound of interest in pharmaceutical chemistry. It serves as an essential intermediate in the synthesis of various pharmaceutical compounds, particularly in the development of medications. This compound plays a pivotal role in the creation of pharmaceutical intermediates, enabling the design and production of potential drug candidates with therapeutic applications.
CAS Number | 151389-99-0 |
Molecular Formula | C8H13N3 |
Purity | ≥95% |
IUPAC Name | N-(2-methylpropyl)pyrimidin-2-amine |
InChI | InChI=1S/C8H13N3/c1-7(2)6-11-8-9-4-3-5-10-8/h3-5,7H,6H2,1-2H3,(H,9,10,11) |
InChIKey | KXCWPZCIOOLNOU-UHFFFAOYSA-N |