For research use only. Not for therapeutic Use.
N-Isopropylaniline-d6 is a deuterated form of N-isopropylaniline, where six hydrogen atoms in the isopropyl group are replaced with deuterium. This isotopic labeling is particularly valuable in analytical chemistry, especially in NMR spectroscopy and mass spectrometry, allowing for precise tracking and differentiation of the compound in various chemical reactions and studies. The deuterium substitution does not alter the chemical reactivity or physical properties of the compound, making N-Isopropylaniline-d6 a useful tool in research focused on reaction mechanisms, metabolic pathways, and environmental behavior.
Catalog Number | R043188 |
CAS Number | 67699-91-6 |
Synonyms | N-[1-(Methyl-d3)ethyl-2,2,2-d3]-benzenamine |
Molecular Formula | C9H13N |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)aniline |
InChI | InChI=1S/C9H13N/c1-8(2)10-9-6-4-3-5-7-9/h3-8,10H,1-2H3/i1D3,2D3 |
InChIKey | FRCFWPVMFJMNDP-WFGJKAKNSA-N |
SMILES | CC(C)NC1=CC=CC=C1 |