For research use only. Not for therapeutic Use.
N-Isovalerylglutamic acid（Cat No.:I033338） is classified as an organic compound belonging to the group of glutamic acid and derivatives. These compounds consist of glutamic acid or its derivatives, which are formed through reactions at the amino or carboxy groups of glutamic acid or by substituting a hydrogen atom of glycine with a heteroatom. N-Isovalerylglutamic acid specifically contains an isovaleryl group attached to the glutamic acid molecule. Glutamic acid and its derivatives play important roles in various biological processes, including protein synthesis and neurotransmission.
| Catalog Number | I033338 |
| CAS Number | 80154-63-8 |
| Synonyms | N-Isovalerylglutamic acid; N-Ivga; |
| Molecular Formula | C10H17NO5 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Room Temperature |
| IUPAC Name | (3-methylbutanoyl)-L-glutamic acid |
| InChI | InChI=1S/C10H17NO5/c1-6(2)5-8(12)11-7(10(15)16)3-4-9(13)14/h6-7H,3-5H2,1-2H3,(H,11,12)(H,13,14)(H,15,16)/t7-/m0/s1 |
| InChIKey | HCVIJONZMYVLAW-ZETCQYMHSA-N |
| SMILES | O=C(O)CC[C@@H](C(O)=O)NC(CC(C)C)=O |
| Reference | 1: Niederwieser A, Steinmann B, Exner U, Neuheiser F, Redweik U, Wang M, Rampini S, Wendel U. Multiple acyl-Co A dehydrogenation deficiency (MADD) in a boy with nonketotic hypoglycemia, hepatomegaly, muscle hypotonia and cardiomyopathy. Detection of N-isovalerylglutamic acid and its monoamide. Helv Paediatr Acta. 1983 Mar;38(1):9-26. PubMed PMID: 6862997. |
