For research use only. Not for therapeutic Use.
N-(Ketocaproyl)-L-homoserine Lactone (Cat No.:R002050) is a bacterial signaling molecule known as an acyl-homoserine lactone (AHL) involved in quorum sensing in Gram-negative bacteria. It facilitates cell-to-cell communication, enabling bacteria to coordinate gene expression based on population density, which regulates processes like biofilm formation, virulence, and motility. This compound is particularly studied in Pseudomonas and Vibrio species for its role in pathogenicity and biofilm development. N-(Ketocaproyl)-L-homoserine Lactone is valuable in microbial research for understanding bacterial behavior, infection control, and the development of quorum-sensing inhibitors as potential therapeutics.
Catalog Number | R002050 |
CAS Number | 143537-62-6 |
Synonyms | N-(3-Oxohexanoyl)-homoserine Lactone; (S)-3-Oxo-N-(tetrahydro-2-oxo-3-furanyl)hexanamide; |
Molecular Formula | C10H15NO4 |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | 3-oxo-N-[(3S)-2-oxooxolan-3-yl]hexanamide |
InChI | InChI=1S/C10H15NO4/c1-2-3-7(12)6-9(13)11-8-4-5-15-10(8)14/h8H,2-6H2,1H3,(H,11,13)/t8-/m0/s1 |
InChIKey | YRYOXRMDHALAFL-QMMMGPOBSA-N |
SMILES | CCCC(=O)CC(=O)N[C@H]1CCOC1=O |