For research use only. Not for therapeutic Use.
N-Linoleoylethanolamine-d4(Cat No.:R025122)is a high-purity, deuterated compound essential for advanced pharmaceutical and biochemical research. This isotopically labeled version of N-Linoleoylethanolamine, featuring four deuterium atoms, is crucial for studies on lipid metabolism, signaling pathways, and NMR spectroscopy. The stable isotope labeling ensures precise and reliable analytical results, enhancing the accuracy of experimental data. Ideal for various research applications, N-Linoleoylethanolamine-d4 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations and the development of innovative therapeutic agents.
Catalog Number | R025122 |
CAS Number | 1451194-69-6 |
Synonyms | (9Z,12Z)-N-(2-Hydroxyethyl-1,1,2,2-d4)-9,12-octadecadienamide; (9Z,12Z)-N-(2-Hydroxyethyl-d4)-9,12-octadecadienamide; N-(2-Hydroxyethyl-d4)linoleamide; Linoleic Acid Monoethanolamide; N-(2-Hydroxyethyl-d4)-(Z,Z)-9,12-octadecadienamide |
Molecular Formula | C20H37NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (9Z,12Z)-N-(1,1,2,2-tetradeuterio-2-hydroxyethyl)octadeca-9,12-dienamide |
InChI | InChI=1S/C20H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)21-18-19-22/h6-7,9-10,22H,2-5,8,11-19H2,1H3,(H,21,23)/b7-6-,10-9-/i18D2,19D2 |
InChIKey | KQXDGUVSAAQARU-UKNLGWMGSA-N |
SMILES | [2H]C([2H])(C([2H])([2H])O)NC(=O)CCCCCCC/C=C\C/C=C\CCCCC |