For research use only. Not for therapeutic Use.
N-Methoxy-N-methyl-3-phenyl-propionamide(Cat No.:M038451) is an organic compound that belongs to the amide class. It consists of a propionamide backbone substituted with a phenyl group at the 3-position and further modified with methoxy and methyl groups attached to the nitrogen atom. This molecular structure makes it an interesting compound in organic synthesis, particularly in the role of a reagent or intermediate. Its utility often lies in the synthesis of other complex organic molecules, where the presence of the amide group can facilitate bond formation through various chemical reactions. This compound’s modifications enhance its reactivity and solubility in organic solvents.
CAS Number | 170646-96-5 |
Molecular Formula | C11H15NO2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | N-methoxy-N-methyl-3-phenylpropanamide |
InChI | InChI=1S/C11H15NO2/c1-12(14-2)11(13)9-8-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3 |
InChIKey | ANVULNURROKXKS-UHFFFAOYSA-N |
SMILES | CN(C(=O)CCC1=CC=CC=C1)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |