Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> N-Methyl-1-(1-methylpiperidin-4-yl)methanamine
For research use only. Not for therapeutic Use.
N-Methyl-1-(1-methylpiperidin-4-yl)methanamine(CAT: L006664) is a chemical compound with potential applications in various scientific domains. Its structure includes a piperidine ring and a methylamine group, suggesting diverse interactions. This compound may engage with specific biological targets, making it interesting in medicinal chemistry and drug development. Its mode of action could involve the modulation of cellular processes, potentially influencing disease-related pathways. Its distinct chemical attributes enable the design of novel compounds for applications in pharmaceuticals, materials science, and chemical research.
CAS Number | 405928-19-0 |
Molecular Formula | C8H18N2 |
Purity | ≥95% |
IUPAC Name | N-methyl-1-(1-methylpiperidin-4-yl)methanamine |
InChI | InChI=1S/C8H18N2/c1-9-7-8-3-5-10(2)6-4-8/h8-9H,3-7H2,1-2H3 |
InChIKey | WGDFDUYIZTVXJR-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |