For research use only. Not for therapeutic Use.
N-Methyl-1H-pyrazole-3-carboxamide(Cat No.:L007203), is a chemical compound with the molecular formula C5H7N3O. It features a pyrazole ring—a five-membered heterocyclic structure—substituted with a carboxamide group at the 3rd position and a methyl group at the N position. This compound is significant in organic synthesis and medicinal chemistry research. Its pyrazole motif is often found in pharmaceuticals, making it valuable in drug discovery. Researchers explore derivatives of N-Methyl-1H-pyrazole-3-carboxamide for various pharmacological applications, making it a subject of interest in the development of new pharmaceutical agents, contributing to advancements in medicinal chemistry and drug design efforts.
CAS Number | 701214-21-3 |
Molecular Formula | C5H7N3O |
Purity | ≥95% |
IUPAC Name | N-methyl-1H-pyrazole-5-carboxamide |
InChI | InChI=1S/C5H7N3O/c1-6-5(9)4-2-3-7-8-4/h2-3H,1H3,(H,6,9)(H,7,8) |
InChIKey | DMIFIPICRBGFTI-UHFFFAOYSA-N |
SMILES | CNC(=O)C1=CC=NN1 |