For research use only. Not for therapeutic Use.
N-Methyl-3-pyrrolidinyl Cyclopentylmandelate (CAT: R008583) is a compound that exists as a mixture of diastereomers. It serves as an intermediate in the synthesis of various pharmaceutical compounds. This compound plays a crucial role in the preparation of diverse chemical structures with potential pharmacological activities. The mixture of diastereomers can undergo further transformations to yield complex molecules with distinct properties.
CAS Number | 13118-11-1 |
Synonyms | α-Cyclopentyl-α-hydroxy-benzeneacetic Acid 1-Methyl-3-pyrrolidinyl Ester;?α-Cyclopentyl-mandelic Acid 1-Methyl-3-pyrrolidinyl Ester; Glycopyrrolate Related Compound B |
Molecular Formula | C18H25NO3 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (1-methylpyrrolidin-3-yl) 2-cyclopentyl-2-hydroxy-2-phenylacetate |
InChI | InChI=1S/C18H25NO3/c1-19-12-11-16(13-19)22-17(20)18(21,15-9-5-6-10-15)14-7-3-2-4-8-14/h2-4,7-8,15-16,21H,5-6,9-13H2,1H3 |
InChIKey | OVGMKPGXRHJNKJ-UHFFFAOYSA-N |
SMILES | CN1CCC(C1)OC(=O)C(C2CCCC2)(C3=CC=CC=C3)O |