For research use only. Not for therapeutic Use.
N-Methyl-3,4-dihydroxyamphetamine hydrochloride (Cat No.:M080872) is a hydrochloride salt form of N-Methyl-3,4-dihydroxyamphetamine, a psychoactive compound related to both amphetamines and phenethylamines. Its structure features a methamphetamine core substituted with two hydroxyl groups at the 3rd and 4th positions, making it similar in structure to hormones like dopamine and neurotransmitters like norepinephrine. MDA-HCl is primarily known for its use in psychopharmacology as a stimulant and entactogen, producing effects that include euphoria, increased energy, and enhanced sensory perception. It has also been used in therapeutic settings and research into emotional and psychological healing.
| Catalog Number | M080872 |
| CAS Number | 15398-87-5 |
| Molecular Formula | C10H15NO2 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | 4-[2-(methylamino)propyl]benzene-1,2-diol |
| InChI | InChI=1S/C10H15NO2/c1-7(11-2)5-8-3-4-9(12)10(13)6-8/h3-4,6-7,11-13H,5H2,1-2H3 |
| InChIKey | NTCPGTZTPGFNOM-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC(=C(C=C1)O)O)NC |
