For research use only. Not for therapeutic Use.
N-Methyl-3,4-dihydroxyamphetamine hydrochloride (Cat No.:M080872) is a hydrochloride salt form of N-Methyl-3,4-dihydroxyamphetamine, a psychoactive compound related to both amphetamines and phenethylamines. Its structure features a methamphetamine core substituted with two hydroxyl groups at the 3rd and 4th positions, making it similar in structure to hormones like dopamine and neurotransmitters like norepinephrine. MDA-HCl is primarily known for its use in psychopharmacology as a stimulant and entactogen, producing effects that include euphoria, increased energy, and enhanced sensory perception. It has also been used in therapeutic settings and research into emotional and psychological healing.
CAS Number | 15398-87-5 |
Molecular Formula | C10H15NO2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 4-[2-(methylamino)propyl]benzene-1,2-diol |
InChI | InChI=1S/C10H15NO2/c1-7(11-2)5-8-3-4-9(12)10(13)6-8/h3-4,6-7,11-13H,5H2,1-2H3 |
InChIKey | NTCPGTZTPGFNOM-UHFFFAOYSA-N |
SMILES | CC(CC1=CC(=C(C=C1)O)O)NC |