For research use only. Not for therapeutic Use.
N-Methyl-4-nitrophenethylamine hydrochloride(Cat No.:M044971), is a chemical compound with applications in research and pharmaceutical development. It is a crystalline solid typically used as an intermediate or precursor in the synthesis of various organic compounds, especially those of medicinal interest. The hydrochloride salt form of this compound enhances its stability and solubility, making it suitable for laboratory use.
CAS Number | 166943-39-1 |
Molecular Formula | C9H13ClN2O2 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | N-methyl-2-(4-nitrophenyl)ethanamine;hydrochloride |
InChI | InChI=1S/C9H12N2O2.ClH/c1-10-7-6-8-2-4-9(5-3-8)11(12)13;/h2-5,10H,6-7H2,1H3;1H |
InChIKey | VGJDSNZOPPZCTB-UHFFFAOYSA-N |
SMILES | CNCCC1=CC=C(C=C1)[N+](=O)[O-].Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |