For research use only, not for therapeutic use.
MPP MPP The key features of different neurotoxic models of Parkinson’s disease, including the MPTP model, have been detailed.
| Catalog Number | R054161 |
| CAS Number | 36913-39-0 |
| Synonyms | 1-Methyl-4-phenylpyridinium Iodide; MPP+ Iodide; |
| Molecular Formula | C12H12IN |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-methyl-4-phenylpyridin-1-ium;iodide |
| InChI | InChI=1S/C12H12N.HI/c1-13-9-7-12(8-10-13)11-5-3-2-4-6-11;/h2-10H,1H3;1H/q+1;/p-1 |
| InChIKey | RFDFRDXIIKROAI-UHFFFAOYSA-M |
| SMILES | C[N+]1=CC=C(C=C1)C2=CC=CC=C2.[I-] |
