For research use only. Not for therapeutic Use.
N-Methyl-L-alanine(CAT: R014871) is an amino acid derivative and a structural isomer of the non-proteinogenic amino acid L-alanine. N-Methyl-L-alanine has been found to occur naturally in certain species of cyanobacteria (blue-green algae). However, it is considered a neurotoxic amino acid and has been implicated in cases of neurological disease and even death in humans and animals.
CAS Number | 3913-67-5 |
Synonyms | (S)-2-(Methylamino)propanoic Acid; (S)-N-Methylalanine; 2-(Methylamino)propanoic Acid; N-Methylalanine; α-(Methylamino)propionic Acid |
Molecular Formula | C4H9NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2S)-2-(methylamino)propanoic acid |
InChI | InChI=1S/C4H9NO2/c1-3(5-2)4(6)7/h3,5H,1-2H3,(H,6,7)/t3-/m0/s1 |
InChIKey | GDFAOVXKHJXLEI-VKHMYHEASA-N |
SMILES | CC(C(=O)O)NC |