For research use only. Not for therapeutic Use.
N-methyl-N-dithiocarboxyglucamine sodium(Cat No.:R011915)is a chemical compound that has potential applications in various fields, including medicinal chemistry and pharmaceutical research. It is primarily studied for its role as a chelating agent, capable of binding to metal ions and forming stable complexes. This property makes it of interest in the treatment of heavy metal poisoning or for drug delivery systems that require metal ion interactions. Researchers investigate its molecular structure, safety profile, and efficacy to determine its potential therapeutic uses, particularly in the context of detoxification and targeted drug therapy.
CAS Number | 91840-27-6 |
Synonyms | sodium;N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamodithioate |
Molecular Formula | C8H16NNaO5S2 |
Purity | ≥95% |
Documentation | |
IUPAC Name | sodium;N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamodithioate |
InChI | InChI=1S/C8H17NO5S2.Na/c1-9(8(15)16)2-4(11)6(13)7(14)5(12)3-10;/h4-7,10-14H,2-3H2,1H3,(H,15,16);/q;+1/p-1/t4-,5+,6+,7+;/m0./s1 |
InChIKey | PLQRBFAACWRSKF-LJTMIZJLSA-M |
SMILES | CN(C[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O)C(=S)[S-].[Na+] |