For research use only. Not for therapeutic Use.
Butenafine(Cat No.:M013161)is a synthetic benzylamine antifungal agent commonly applied topically to treat superficial fungal infections of the skin, including athlete’s foot, jock itch, and ringworm. By inhibiting the enzyme squalene epoxidase, it disrupts ergosterol synthesis, weakening the fungal cell membrane and hindering growth. Unlike some related antifungals, butenafine often requires fewer applications and may provide longer-lasting protection, improving patient compliance. It generally shows low systemic absorption and is well tolerated, with minimal side effects like mild irritation. Widely used, it helps maintain healthier, fungus-free skin.
CAS Number | 101828-21-1 |
Molecular Formula | C23H27N |
Purity | ≥95% |
Target | Fungal |
Storage | -20°C |
IUPAC Name | 1-(4-tert-butylphenyl)-N-methyl-N-(naphthalen-1-ylmethyl)methanamine |
InChI | InChI=1S/C23H27N/c1-23(2,3)21-14-12-18(13-15-21)16-24(4)17-20-10-7-9-19-8-5-6-11-22(19)20/h5-15H,16-17H2,1-4H3 |
InChIKey | ABJKWBDEJIDSJZ-UHFFFAOYSA-N |
SMILES | CC(C)(C)C1=CC=C(C=C1)CN(C)CC2=CC=CC3=CC=CC=C32 |